C21H22 — CID 144739295
ethane;3-(3-phenylphenyl)cyclohepta-1,3,5-triene (PubChem CID 144739295) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is ethane;3-(3-phenylphenyl)cyclohepta-1,3,5-triene.
| Compound Name | ethane;3-(3-phenylphenyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 144739295 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | ethane;3-(3-phenylphenyl)cyclohepta-1,3,5-triene |
| SMILES | C1=CCC=CC(c2cccc(-c3ccccc3)c2)=C1.CC |
| InChI | InChI=1S/C19H16.C2H6/c1-2-5-10-16(9-4-1)18-13-8-14-19(15-18)17-11-6-3-7-12-17;1-2/h1,3-15H,2H2;1-2H3 |
| InChIKey | TZISOWQXALLORJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |