C33H30 — CID 142357133
3-[4-[3-[3-[(3E,5Z)-octa-3,5,7-trien-4-yl]phenyl]phenyl]phenyl]cyclohepta-1,3,5-triene (PubChem CID 142357133) has the molecular formula C33H30 and a molecular weight of 426.60 g/mol. Its IUPAC name is 3-[4-[3-[3-[(3E,5Z)-octa-3,5,7-trien-4-yl]phenyl]phenyl]phenyl]cyclohepta-1,3,5-triene.
| Compound Name | 3-[4-[3-[3-[(3E,5Z)-octa-3,5,7-trien-4-yl]phenyl]phenyl]phenyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142357133 |
| Molecular Formula | C33H30 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[4-[3-[3-[(3E,5Z)-octa-3,5,7-trien-4-yl]phenyl]phenyl]phenyl]cyclohepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/CC)c1cccc(-c2cccc(-c3ccc(C4=CC=CCC=C4)cc3)c2)c1 |
| InChI | InChI=1S/C33H30/c1-3-5-13-26(12-4-2)30-16-10-18-32(24-30)33-19-11-17-31(25-33)29-22-20-28(21-23-29)27-14-8-6-7-9-15-27/h3,5-6,8-25H,1,4,7H2,2H3/b13-5-,26-12+ |
| InChIKey | LZSGWPZUCBRFOM-YMOMDMQFSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|