C50H41NO — CID 145437085
2-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E)-hexa-1,3-dien-3-yl]phenyl]-4,6-bis(3-phenylphenyl)-1,3-benzoxazole (PubChem CID 145437085) has the molecular formula C50H41NO and a molecular weight of 671.88 g/mol. Its IUPAC name is 2-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E)-hexa-1,3-dien-3-yl]phenyl]-4,6-bis(3-phenylphenyl)-1,3-benzoxazole.
| Compound Name | 2-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E)-hexa-1,3-dien-3-yl]phenyl]-4,6-bis(3-phenylphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 145437085 |
| Molecular Formula | C50H41NO |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.32 |
| IUPAC Name | 2-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[(3E)-hexa-1,3-dien-3-yl]phenyl]-4,6-bis(3-phenylphenyl)-1,3-benzoxazole |
| SMILES | C=C/C=C\C(=C/C)c1cc(/C(C=C)=C/CC)cc(-c2nc3c(-c4cccc(-c5ccccc5)c4)cc(-c4cccc(-c5ccccc5)c4)cc3o2)c1 |
| InChI | InChI=1S/C50H41NO/c1-5-9-19-36(8-4)44-30-43(35(7-3)18-6-2)31-46(32-44)50-51-49-47(42-27-17-25-40(29-42)38-22-14-11-15-23-38)33-45(34-48(49)52-50)41-26-16-24-39(28-41)37-20-12-10-13-21-37/h5,7-34H,1,3,6H2,2,4H3/b19-9-,35-18+,36-8+ |
| InChIKey | SLRBVVWMKMTBGE-SMAVZMIQSA-N |
| XLogP | 14.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|