C36H27N3O — CID 159462054
2-[5-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-pyridin-3-ylphenyl]-2-pyridin-3-ylphenyl]-1,3-benzoxazole (PubChem CID 159462054) has the molecular formula C36H27N3O and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-[5-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-pyridin-3-ylphenyl]-2-pyridin-3-ylphenyl]-1,3-benzoxazole.
| Compound Name | 2-[5-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-pyridin-3-ylphenyl]-2-pyridin-3-ylphenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 159462054 |
| Molecular Formula | C36H27N3O |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[5-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-pyridin-3-ylphenyl]-2-pyridin-3-ylphenyl]-1,3-benzoxazole |
| SMILES | C=C/C=C\C(=C/C)c1cc(-c2cccnc2)cc(-c2ccc(-c3cccnc3)c(-c3nc4ccccc4o3)c2)c1 |
| InChI | InChI=1S/C36H27N3O/c1-3-5-10-25(4-2)29-19-30(21-31(20-29)27-11-8-17-37-23-27)26-15-16-32(28-12-9-18-38-24-28)33(22-26)36-39-34-13-6-7-14-35(34)40-36/h3-24H,1H2,2H3/b10-5-,25-4+ |
| InChIKey | LUSCLMPQUAUSMK-OPRVTKGRSA-N |
| XLogP | 9.43 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|