C31H36N2 — CID 144787326
3-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-pyridin-3-ylphenyl]pyridine;bis(prop-1-ene) (PubChem CID 144787326) has the molecular formula C31H36N2 and a molecular weight of 436.64 g/mol. Its IUPAC name is 3-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-pyridin-3-ylphenyl]pyridine;bis(prop-1-ene).
| Compound Name | 3-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-pyridin-3-ylphenyl]pyridine;bis(prop-1-ene) |
|---|---|
| PubChem CID | 144787326 |
| Molecular Formula | C31H36N2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 3-[3-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]-5-pyridin-3-ylphenyl]pyridine;bis(prop-1-ene) |
| SMILES | C=C(C)/C=C(\C=C(C)C)c1cc(-c2cccnc2)cc(-c2cccnc2)c1.C=CC.C=CC |
| InChI | InChI=1S/C25H24N2.2C3H6/c1-18(2)11-22(12-19(3)4)25-14-23(20-7-5-9-26-16-20)13-24(15-25)21-8-6-10-27-17-21;2*1-3-2/h5-17H,1H2,2-4H3;2*3H,1H2,2H3/b22-11+;; |
| InChIKey | SWRNYPMTTRVDME-QLVZFOIYSA-N |
| XLogP | 9.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|