C41H38N4 — CID 175623082
4-[3-[(2E,4Z)-hepta-2,4-dien-3-yl]-5-pyridin-3-ylphenyl]-6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]-2-methylpyrimidine (PubChem CID 175623082) has the molecular formula C41H38N4 and a molecular weight of 586.78 g/mol. Its IUPAC name is 4-[3-[(2E,4Z)-hepta-2,4-dien-3-yl]-5-pyridin-3-ylphenyl]-6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]-2-methylpyrimidine.
| Compound Name | 4-[3-[(2E,4Z)-hepta-2,4-dien-3-yl]-5-pyridin-3-ylphenyl]-6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 175623082 |
| Molecular Formula | C41H38N4 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | 4-[3-[(2E,4Z)-hepta-2,4-dien-3-yl]-5-pyridin-3-ylphenyl]-6-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]-2-methylpyrimidine |
| SMILES | C=C/C(=C\C=C/C)c1cc(-c2cccnc2)cc(-c2cc(-c3cc(C(/C=C\CC)=C/C)cc(-c4cccnc4)c3)nc(C)n2)c1 |
| InChI | InChI=1S/C41H38N4/c1-6-10-14-30(8-3)34-20-36(32-16-12-18-42-27-32)24-38(22-34)40-26-41(45-29(5)44-40)39-23-35(31(9-4)15-11-7-2)21-37(25-39)33-17-13-19-43-28-33/h6,8-28H,3,7H2,1-2,4-5H3/b10-6-,15-11-,30-14+,31-9+ |
| InChIKey | ORYDQCPCIJYZSY-ZCKOZDHSSA-N |
| XLogP | 10.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|