C39H39N3 — CID 143250798
(1E,3Z,5Z)-3-[3-[6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(4-phenylphenyl)-2-pyridinyl]phenyl]-4-N-methylocta-1,3,5-triene-1,4-diamine (PubChem CID 143250798) has the molecular formula C39H39N3 and a molecular weight of 549.76 g/mol. Its IUPAC name is (1E,3Z,5Z)-3-[3-[6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(4-phenylphenyl)-2-pyridinyl]phenyl]-4-N-methylocta-1,3,5-triene-1,4-diamine.
| Compound Name | (1E,3Z,5Z)-3-[3-[6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(4-phenylphenyl)-2-pyridinyl]phenyl]-4-N-methylocta-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 143250798 |
| Molecular Formula | C39H39N3 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (1E,3Z,5Z)-3-[3-[6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-(4-phenylphenyl)-2-pyridinyl]phenyl]-4-N-methylocta-1,3,5-triene-1,4-diamine |
| SMILES | C=C/C(=C\C=C/C)c1cc(-c2ccc(-c3ccccc3)cc2)cc(-c2cccc(C(/C=C/N)=C(/C=C\CC)NC)c2)n1 |
| InChI | InChI=1S/C39H39N3/c1-5-8-14-29(7-3)38-27-35(32-22-20-31(21-23-32)30-15-11-10-12-16-30)28-39(42-38)34-18-13-17-33(26-34)36(24-25-40)37(41-4)19-9-6-2/h5,7-28,41H,3,6,40H2,1-2,4H3/b8-5-,19-9-,25-24+,29-14+,37-36- |
| InChIKey | BUKLSIVONKFWML-ZQZUMXOZSA-N |
| XLogP | 9.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|