C50H42 — CID 123950143
1-[3-(3,5-diphenylphenyl)-5-(4-methylphenyl)phenyl]-3-hepta-2,4-dien-3-yl-5-phenylbenzene (PubChem CID 123950143) has the molecular formula C50H42 and a molecular weight of 642.89 g/mol. Its IUPAC name is 1-[3-(3,5-diphenylphenyl)-5-(4-methylphenyl)phenyl]-3-hepta-2,4-dien-3-yl-5-phenylbenzene.
| Compound Name | 1-[3-(3,5-diphenylphenyl)-5-(4-methylphenyl)phenyl]-3-hepta-2,4-dien-3-yl-5-phenylbenzene |
|---|---|
| PubChem CID | 123950143 |
| Molecular Formula | C50H42 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | 1-[3-(3,5-diphenylphenyl)-5-(4-methylphenyl)phenyl]-3-hepta-2,4-dien-3-yl-5-phenylbenzene |
| SMILES | CC=C(C=CCC)c1cc(-c2ccccc2)cc(-c2cc(-c3ccc(C)cc3)cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C50H42/c1-4-6-16-37(5-2)42-27-43(38-17-10-7-11-18-38)30-47(28-42)49-33-46(41-25-23-36(3)24-26-41)34-50(35-49)48-31-44(39-19-12-8-13-20-39)29-45(32-48)40-21-14-9-15-22-40/h5-35H,4H2,1-3H3 |
| InChIKey | DIRCILNYYLXVAI-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|