C58H45N3 — CID 145174411
2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenyl-6-[3-[4-(2,3,4,5-tetraphenylphenyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 145174411) has the molecular formula C58H45N3 and a molecular weight of 784.02 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenyl-6-[3-[4-(2,3,4,5-tetraphenylphenyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenyl-6-[3-[4-(2,3,4,5-tetraphenylphenyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 145174411 |
| Molecular Formula | C58H45N3 |
| Molecular Weight | 784.02 g/mol |
| Exact Mass | 783.36 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenyl-6-[3-[4-(2,3,4,5-tetraphenylphenyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | C/C=C(\C=C/CC)c1nc(-c2ccccc2)nc(-c2cccc(-c3ccc(-c4cc(-c5ccccc5)c(-c5ccccc5)c(-c5ccccc5)c4-c4ccccc4)cc3)c2)n1 |
| InChI | InChI=1S/C58H45N3/c1-3-5-22-41(4-2)56-59-57(48-31-19-10-20-32-48)61-58(60-56)50-34-21-33-49(39-50)42-35-37-44(38-36-42)52-40-51(43-23-11-6-12-24-43)53(45-25-13-7-14-26-45)55(47-29-17-9-18-30-47)54(52)46-27-15-8-16-28-46/h4-40H,3H2,1-2H3/b22-5-,41-4+ |
| InChIKey | XROLOBWAICLXMD-ZMPFFYAWSA-N |
| XLogP | 15.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.02 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|