C59H48N6O — CID 130440018
2-[3-[9,9-dimethyl-5-[3-[4-(4-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]xanthen-4-yl]phenyl]-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 130440018) has the molecular formula C59H48N6O and a molecular weight of 857.07 g/mol. Its IUPAC name is 2-[3-[9,9-dimethyl-5-[3-[4-(4-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]xanthen-4-yl]phenyl]-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-[9,9-dimethyl-5-[3-[4-(4-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]xanthen-4-yl]phenyl]-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 130440018 |
| Molecular Formula | C59H48N6O |
| Molecular Weight | 857.07 g/mol |
| Exact Mass | 856.39 |
| IUPAC Name | 2-[3-[9,9-dimethyl-5-[3-[4-(4-methylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]xanthen-4-yl]phenyl]-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C(\C=C/CC)c1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4c3Oc3c(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc(C)cc7)n6)c5)cccc3C4(C)C)c2)n1 |
| InChI | InChI=1S/C59H48N6O/c1-6-8-19-39(7-2)53-60-54(40-20-11-9-12-21-40)63-57(61-53)45-26-15-24-43(36-45)47-28-17-30-49-51(47)66-52-48(29-18-31-50(52)59(49,4)5)44-25-16-27-46(37-44)58-64-55(41-22-13-10-14-23-41)62-56(65-58)42-34-32-38(3)33-35-42/h7-37H,6H2,1-5H3/b19-8-,39-7+ |
| InChIKey | ODTNMBRVOZQWJJ-BPOWHJKRSA-N |
| XLogP | 14.84 |
| TPSA | 86.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.07 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|