C49H37N3 — CID 126496247
2-[3-(9,9-dimethylfluoren-2-yl)-5-(4-phenylphenyl)phenyl]-4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 126496247) has the molecular formula C49H37N3 and a molecular weight of 667.86 g/mol. Its IUPAC name is 2-[3-(9,9-dimethylfluoren-2-yl)-5-(4-phenylphenyl)phenyl]-4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[3-(9,9-dimethylfluoren-2-yl)-5-(4-phenylphenyl)phenyl]-4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 126496247 |
| Molecular Formula | C49H37N3 |
| Molecular Weight | 667.86 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | 2-[3-(9,9-dimethylfluoren-2-yl)-5-(4-phenylphenyl)phenyl]-4-[(2E,4Z)-hepta-2,4-dien-6-yn-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C#C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2cc(-c3ccc(-c4ccccc4)cc3)cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c2)n1 |
| InChI | InChI=1S/C49H37N3/c1-5-7-16-33(6-2)46-50-47(37-19-12-9-13-20-37)52-48(51-46)41-30-39(36-25-23-35(24-26-36)34-17-10-8-11-18-34)29-40(31-41)38-27-28-43-42-21-14-15-22-44(42)49(3,4)45(43)32-38/h1,6-32H,2-4H3/b16-7-,33-6+ |
| InChIKey | ZDBAIDLQAAETGU-ZVJDRMJKSA-N |
| XLogP | 12.11 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.86 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|