C36H27N3S — CID 163751907
3-(9,9-dimethylfluoren-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzenethiol (PubChem CID 163751907) has the molecular formula C36H27N3S and a molecular weight of 533.70 g/mol. Its IUPAC name is 3-(9,9-dimethylfluoren-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzenethiol.
| Compound Name | 3-(9,9-dimethylfluoren-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzenethiol |
|---|---|
| PubChem CID | 163751907 |
| Molecular Formula | C36H27N3S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 3-(9,9-dimethylfluoren-2-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzenethiol |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(S)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc21 |
| InChI | InChI=1S/C36H27N3S/c1-36(2)31-16-10-9-15-29(31)30-18-17-25(22-32(30)36)26-19-27(21-28(40)20-26)35-38-33(23-11-5-3-6-12-23)37-34(39-35)24-13-7-4-8-14-24/h3-22,40H,1-2H3 |
| InChIKey | LQRQSRYXJFMATD-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|