C37H29N3 — CID 145334226
2-[3-(9,9-dimethylfluoren-2-yl)-5-methylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 145334226) has the molecular formula C37H29N3 and a molecular weight of 515.66 g/mol. Its IUPAC name is 2-[3-(9,9-dimethylfluoren-2-yl)-5-methylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(9,9-dimethylfluoren-2-yl)-5-methylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145334226 |
| Molecular Formula | C37H29N3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 2-[3-(9,9-dimethylfluoren-2-yl)-5-methylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C37H29N3/c1-24-20-28(27-18-19-31-30-16-10-11-17-32(30)37(2,3)33(31)23-27)22-29(21-24)36-39-34(25-12-6-4-7-13-25)38-35(40-36)26-14-8-5-9-15-26/h4-23H,1-3H3 |
| InChIKey | ICBKWPDNBWMCCX-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |