C64H47N3 — CID 153302646
2-(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)-6-(3,5-diphenylphenyl)-1,3,5-triazine (PubChem CID 153302646) has the molecular formula C64H47N3 and a molecular weight of 858.10 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)-6-(3,5-diphenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)-6-(3,5-diphenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 153302646 |
| Molecular Formula | C64H47N3 |
| Molecular Weight | 858.10 g/mol |
| Exact Mass | 857.38 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)-6-(3,5-diphenylphenyl)-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)nc(-c4ccc5c(c4)C4(c6ccccc6-5)c5ccccc5C(C)(C)c5ccccc54)n3)cc21 |
| InChI | InChI=1S/C64H47N3/c1-62(2)51-25-13-11-23-47(51)49-33-31-42(38-57(49)62)59-65-60(67-61(66-59)46-36-44(40-19-7-5-8-20-40)35-45(37-46)41-21-9-6-10-22-41)43-32-34-50-48-24-12-14-26-52(48)64(58(50)39-43)55-29-17-15-27-53(55)63(3,4)54-28-16-18-30-56(54)64/h5-39H,1-4H3 |
| InChIKey | JVXIAFBSXVJEAY-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.10 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |