C21H26 — CID 165141604
ethane;1-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenylbenzene (PubChem CID 165141604) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenylbenzene.
| Compound Name | ethane;1-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenylbenzene |
|---|---|
| PubChem CID | 165141604 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | ethane;1-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-phenylbenzene |
| SMILES | C/C=C(\C=C/CC)c1ccc(-c2ccccc2)cc1.CC |
| InChI | InChI=1S/C19H20.C2H6/c1-3-5-9-16(4-2)18-12-14-19(15-13-18)17-10-7-6-8-11-17;1-2/h4-15H,3H2,1-2H3;1-2H3/b9-5-,16-4+; |
| InChIKey | PZCWWGBVFWQROK-AIJHPKNYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|