C29H28S2 — CID 144577717
ethane;2-[(2E,4Z)-hepta-2,4-dien-3-yl]-7-phenyl-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 144577717) has the molecular formula C29H28S2 and a molecular weight of 440.68 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-hepta-2,4-dien-3-yl]-7-phenyl-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | ethane;2-[(2E,4Z)-hepta-2,4-dien-3-yl]-7-phenyl-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 144577717 |
| Molecular Formula | C29H28S2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | ethane;2-[(2E,4Z)-hepta-2,4-dien-3-yl]-7-phenyl-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | C/C=C(\C=C/CC)c1ccc2c(c1)sc1c3ccc(-c4ccccc4)cc3sc21.CC |
| InChI | InChI=1S/C27H22S2.C2H6/c1-3-5-9-18(4-2)20-12-14-22-24(16-20)28-27-23-15-13-21(17-25(23)29-26(22)27)19-10-7-6-8-11-19;1-2/h4-17H,3H2,1-2H3;1-2H3/b9-5-,18-4+; |
| InChIKey | IDMSNVITNAHODT-HUMKDRCYSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|