C47H40N4S — CID 145382998
ethane;2-[9-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]dibenzothiophen-2-yl]-4,6-diphenylpyrimidine (PubChem CID 145382998) has the molecular formula C47H40N4S and a molecular weight of 692.93 g/mol. Its IUPAC name is ethane;2-[9-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]dibenzothiophen-2-yl]-4,6-diphenylpyrimidine.
| Compound Name | ethane;2-[9-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]dibenzothiophen-2-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 145382998 |
| Molecular Formula | C47H40N4S |
| Molecular Weight | 692.93 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | ethane;2-[9-[2-[(2E,4Z)-hepta-2,4-dien-3-yl]-6-phenylpyrimidin-4-yl]dibenzothiophen-2-yl]-4,6-diphenylpyrimidine |
| SMILES | C/C=C(\C=C/CC)c1nc(-c2ccccc2)cc(-c2cccc3sc4ccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)cc4c23)n1.CC |
| InChI | InChI=1S/C45H34N4S.C2H6/c1-3-5-16-30(4-2)44-46-39(33-21-13-8-14-22-33)29-40(49-44)35-23-15-24-42-43(35)36-27-34(25-26-41(36)50-42)45-47-37(31-17-9-6-10-18-31)28-38(48-45)32-19-11-7-12-20-32;1-2/h4-29H,3H2,1-2H3;1-2H3/b16-5-,30-4+; |
| InChIKey | ONSZYRTWLPBZDE-BUBHVUFTSA-N |
| XLogP | 13.37 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.93 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|