C42H36N2 — CID 144782355
3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]phenyl]phenyl]pyridine (PubChem CID 144782355) has the molecular formula C42H36N2 and a molecular weight of 568.76 g/mol. Its IUPAC name is 3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]phenyl]phenyl]pyridine.
| Compound Name | 3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 144782355 |
| Molecular Formula | C42H36N2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 3-[3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-[3-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-pyridin-3-ylphenyl]phenyl]phenyl]pyridine |
| SMILES | C=C/C=C\C(=C/C)c1cc(-c2cccnc2)cc(-c2cccc(-c3cc(/C(C=C)=C/C=C\C)cc(-c4cccnc4)c3)c2)c1 |
| InChI | InChI=1S/C42H36N2/c1-5-9-14-31(7-3)37-23-39(27-41(25-37)35-18-12-20-43-29-35)33-16-11-17-34(22-33)40-24-38(32(8-4)15-10-6-2)26-42(28-40)36-19-13-21-44-30-36/h5-30H,1,4H2,2-3H3/b10-6-,14-9-,31-7+,32-15+ |
| InChIKey | FXBLFVIEQNNLPV-ULBCTOPDSA-N |
| XLogP | 11.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|