About 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane
3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane (PubChem CID 143898131) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane.
Molecular Properties
| Compound Name | 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane |
| PubChem CID | 143898131 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane |
| SMILES | C=CC(=C)c1cccc(-c2cccnc2)c1.CC |
| InChI | InChI=1S/C15H13N.C2H6/c1-3-12(2)13-6-4-7-14(10-13)15-8-5-9-16-11-15;1-2/h3-11H,1-2H2;1-2H3 |
| InChIKey | UWCZBYYWTJGVBT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane?
The IUPAC name of 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane (CID 143898131) is 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane.
What is the SMILES notation for 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane?
The canonical SMILES for 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane is C=CC(=C)c1cccc(-c2cccnc2)c1.CC.
What is the InChIKey of 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane?
The InChIKey is UWCZBYYWTJGVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N.C2H6/c1-3-12(2)13-6-4-7-14(10-13)15-8-5-9-16-11-15;1-2/h3-11H,1-2H2;1-2H3.
What are the key properties of 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane?
3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane has a molecular weight of 237.35 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-buta-1,3-dien-2-ylphenyl)pyridine;ethane is sourced from PubChem (CID 143898131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).