C39H29N3 — CID 135199736
(2Z)-4-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]penta-2,4-dien-1-imine (PubChem CID 135199736) has the molecular formula C39H29N3 and a molecular weight of 539.68 g/mol. Its IUPAC name is (2Z)-4-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-4-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 135199736 |
| Molecular Formula | C39H29N3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (2Z)-4-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C(=C)c1cccc(-c2cc(-c3cccc(-c4cccnc4)c3)cc(-c3cccc(-c4cccnc4)c3)c2)c1 |
| InChI | InChI=1S/C39H29N3/c1-28(8-5-17-40)29-9-2-12-32(20-29)37-23-38(33-13-3-10-30(21-33)35-15-6-18-41-26-35)25-39(24-37)34-14-4-11-31(22-34)36-16-7-19-42-27-36/h2-27,40H,1H2/b8-5-,40-17+ |
| InChIKey | QWFJUNOMEQPRDU-DUWUKLMLSA-N |
| XLogP | 10.03 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|