C40H30N4 — CID 144688722
(2Z)-2-[3-[3,9-dimethyl-1-(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinolin-7-yl]phenyl]penta-2,4-dien-1-imine (PubChem CID 144688722) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is (2Z)-2-[3-[3,9-dimethyl-1-(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinolin-7-yl]phenyl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-[3-[3,9-dimethyl-1-(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinolin-7-yl]phenyl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144688722 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (2Z)-2-[3-[3,9-dimethyl-1-(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinolin-7-yl]phenyl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C)c1cccc(-c2cc(C)nc3c2ccc2c3ccc3c(-c4cccc(-c5cccnc5)c4)cc(C)nc32)c1 |
| InChI | InChI=1S/C40H30N4/c1-4-8-31(23-41)27-9-5-11-29(21-27)37-19-25(2)43-39-33-15-17-36-38(20-26(3)44-40(36)34(33)14-16-35(37)39)30-12-6-10-28(22-30)32-13-7-18-42-24-32/h4-24,41H,1H2,2-3H3/b31-8+,41-23+ |
| InChIKey | RLFQBZRQTUFCAH-UDAWBZOTSA-N |
| XLogP | 10.17 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|