C21H23N — CID 145264859
3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N,N-dimethylaniline (PubChem CID 145264859) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N,N-dimethylaniline.
| Compound Name | 3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 145264859 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]phenyl]-N,N-dimethylaniline |
| SMILES | C=C/C(=C\C=C/C)c1ccc(-c2cccc(N(C)C)c2)cc1 |
| InChI | InChI=1S/C21H23N/c1-5-7-9-17(6-2)18-12-14-19(15-13-18)20-10-8-11-21(16-20)22(3)4/h5-16H,2H2,1,3-4H3/b7-5-,17-9+ |
| InChIKey | VBGYAZOHQGFNCY-KXRHHXHKSA-N |
| XLogP | 5.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|