C65H44N2S2 — CID 144537261
4-[3-(2,8-diphenyldibenzothiophen-4-yl)phenyl]-6-[3-[8-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyldibenzothiophen-4-yl]phenyl]pyrimidine (PubChem CID 144537261) has the molecular formula C65H44N2S2 and a molecular weight of 917.22 g/mol. Its IUPAC name is 4-[3-(2,8-diphenyldibenzothiophen-4-yl)phenyl]-6-[3-[8-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyldibenzothiophen-4-yl]phenyl]pyrimidine.
| Compound Name | 4-[3-(2,8-diphenyldibenzothiophen-4-yl)phenyl]-6-[3-[8-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyldibenzothiophen-4-yl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 144537261 |
| Molecular Formula | C65H44N2S2 |
| Molecular Weight | 917.22 g/mol |
| Exact Mass | 916.29 |
| IUPAC Name | 4-[3-(2,8-diphenyldibenzothiophen-4-yl)phenyl]-6-[3-[8-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-phenyldibenzothiophen-4-yl]phenyl]pyrimidine |
| SMILES | C=C/C(=C\C=C/C)c1ccc2sc3c(-c4cccc(-c5cc(-c6cccc(-c7cc(-c8ccccc8)cc8c7sc7ccc(-c9ccccc9)cc78)c6)ncn5)c4)cc(-c4ccccc4)cc3c2c1 |
| InChI | InChI=1S/C65H44N2S2/c1-3-5-17-42(4-2)46-28-30-62-56(34-46)58-38-52(44-20-11-7-12-21-44)36-54(64(58)68-62)48-24-15-26-50(32-48)60-40-61(67-41-66-60)51-27-16-25-49(33-51)55-37-53(45-22-13-8-14-23-45)39-59-57-35-47(43-18-9-6-10-19-43)29-31-63(57)69-65(55)59/h3-41H,2H2,1H3/b5-3-,42-17+ |
| InChIKey | AYUOHJLQRLMKPJ-YTEOQWNNSA-N |
| XLogP | 19.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.22 |
| LogP ≤ 5 | 19.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|