C29H28S — CID 144892948
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(4-methylphenyl)dibenzothiophene;prop-1-ene (PubChem CID 144892948) has the molecular formula C29H28S and a molecular weight of 408.61 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(4-methylphenyl)dibenzothiophene;prop-1-ene.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(4-methylphenyl)dibenzothiophene;prop-1-ene |
|---|---|
| PubChem CID | 144892948 |
| Molecular Formula | C29H28S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-(4-methylphenyl)dibenzothiophene;prop-1-ene |
| SMILES | C=C/C(=C\C=C/C)c1ccc2sc3ccc(-c4ccc(C)cc4)cc3c2c1.C=CC |
| InChI | InChI=1S/C26H22S.C3H6/c1-4-6-7-19(5-2)21-12-14-25-23(16-21)24-17-22(13-15-26(24)27-25)20-10-8-18(3)9-11-20;1-3-2/h4-17H,2H2,1,3H3;3H,1H2,2H3/b6-4-,19-7+; |
| InChIKey | DMKWIKQNMPTZMN-MQEABKFBSA-N |
| XLogP | 9.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|