C49H49N3O3 — CID 118983471
(3E)-5-[3,5-bis[3-(1-hydroxypropan-2-yl)-5-pyridin-3-ylphenyl]phenyl]-2-methyl-3-[(E)-2-pyridin-3-ylprop-1-enyl]hexa-3,5-dien-1-ol (PubChem CID 118983471) has the molecular formula C49H49N3O3 and a molecular weight of 727.95 g/mol. Its IUPAC name is (3E)-5-[3,5-bis[3-(1-hydroxypropan-2-yl)-5-pyridin-3-ylphenyl]phenyl]-2-methyl-3-[(E)-2-pyridin-3-ylprop-1-enyl]hexa-3,5-dien-1-ol.
| Compound Name | (3E)-5-[3,5-bis[3-(1-hydroxypropan-2-yl)-5-pyridin-3-ylphenyl]phenyl]-2-methyl-3-[(E)-2-pyridin-3-ylprop-1-enyl]hexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 118983471 |
| Molecular Formula | C49H49N3O3 |
| Molecular Weight | 727.95 g/mol |
| Exact Mass | 727.38 |
| IUPAC Name | (3E)-5-[3,5-bis[3-(1-hydroxypropan-2-yl)-5-pyridin-3-ylphenyl]phenyl]-2-methyl-3-[(E)-2-pyridin-3-ylprop-1-enyl]hexa-3,5-dien-1-ol |
| SMILES | C=C(/C=C(\C=C(/C)c1cccnc1)C(C)CO)c1cc(-c2cc(-c3cccnc3)cc(C(C)CO)c2)cc(-c2cc(-c3cccnc3)cc(C(C)CO)c2)c1 |
| InChI | InChI=1S/C49H49N3O3/c1-32(37-9-6-12-50-26-37)15-40(34(3)29-53)16-33(2)41-17-46(48-21-42(35(4)30-54)19-44(23-48)38-10-7-13-51-27-38)25-47(18-41)49-22-43(36(5)31-55)20-45(24-49)39-11-8-14-52-28-39/h6-28,34-36,53-55H,2,29-31H2,1,3-5H3/b32-15+,40-16+ |
| InChIKey | LFLLIGHSGAQXKO-YCHDRQIGSA-N |
| XLogP | 10.40 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.95 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|