C24H21BrN2 — CID 145370653
2-(4-bromophenyl)-4-cyclohepta-1,3,6-trien-1-yl-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine (PubChem CID 145370653) has the molecular formula C24H21BrN2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-cyclohepta-1,3,6-trien-1-yl-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine.
| Compound Name | 2-(4-bromophenyl)-4-cyclohepta-1,3,6-trien-1-yl-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine |
|---|---|
| PubChem CID | 145370653 |
| Molecular Formula | C24H21BrN2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-(4-bromophenyl)-4-cyclohepta-1,3,6-trien-1-yl-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrimidine |
| SMILES | C=C/C=C(\C=C/C)c1cc(C2=CC=CCC=C2)nc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C24H21BrN2/c1-3-9-18(10-4-2)22-17-23(19-11-7-5-6-8-12-19)27-24(26-22)20-13-15-21(25)16-14-20/h3-5,7-17H,1,6H2,2H3/b10-4-,18-9+ |
| InChIKey | WAICUUUZFQKCHB-WPAOCOIMSA-N |
| XLogP | 6.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|