C26H23Br — CID 144640238
4-[3-(4-bromophenyl)phenyl]-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylbenzene (PubChem CID 144640238) has the molecular formula C26H23Br and a molecular weight of 415.37 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)phenyl]-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylbenzene.
| Compound Name | 4-[3-(4-bromophenyl)phenyl]-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylbenzene |
|---|---|
| PubChem CID | 144640238 |
| Molecular Formula | C26H23Br |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-[3-(4-bromophenyl)phenyl]-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylbenzene |
| SMILES | C=C/C=C(\C=C/C)c1cc(-c2cccc(-c3ccc(Br)cc3)c2)ccc1C |
| InChI | InChI=1S/C26H23Br/c1-4-7-21(8-5-2)26-18-24(12-11-19(26)3)23-10-6-9-22(17-23)20-13-15-25(27)16-14-20/h4-18H,1H2,2-3H3/b8-5-,21-7+ |
| InChIKey | UIMJHUDLEFWRAY-JKUIXUGWSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|