C31H26 — CID 145299688
1-[(1Z,3E)-3-(4-methylphenyl)hexa-1,3,5-trienyl]-4-(3-phenylphenyl)benzene (PubChem CID 145299688) has the molecular formula C31H26 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(1Z,3E)-3-(4-methylphenyl)hexa-1,3,5-trienyl]-4-(3-phenylphenyl)benzene.
| Compound Name | 1-[(1Z,3E)-3-(4-methylphenyl)hexa-1,3,5-trienyl]-4-(3-phenylphenyl)benzene |
|---|---|
| PubChem CID | 145299688 |
| Molecular Formula | C31H26 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[(1Z,3E)-3-(4-methylphenyl)hexa-1,3,5-trienyl]-4-(3-phenylphenyl)benzene |
| SMILES | C=C/C=C(\C=C/c1ccc(-c2cccc(-c3ccccc3)c2)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H26/c1-3-8-26(28-18-13-24(2)14-19-28)20-15-25-16-21-29(22-17-25)31-12-7-11-30(23-31)27-9-5-4-6-10-27/h3-23H,1H2,2H3/b20-15-,26-8+ |
| InChIKey | SSOORBAKMCMBSB-GKNGVQOFSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|