C23H19N — CID 144554230
(2E,4Z)-3-phenyl-5-(4-phenylphenyl)penta-2,4-dien-1-imine (PubChem CID 144554230) has the molecular formula C23H19N and a molecular weight of 309.41 g/mol. Its IUPAC name is (2E,4Z)-3-phenyl-5-(4-phenylphenyl)penta-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-3-phenyl-5-(4-phenylphenyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 144554230 |
| Molecular Formula | C23H19N |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2E,4Z)-3-phenyl-5-(4-phenylphenyl)penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(\C=C/c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N/c24-18-17-23(21-9-5-2-6-10-21)16-13-19-11-14-22(15-12-19)20-7-3-1-4-8-20/h1-18,24H/b16-13-,23-17+,24-18+ |
| InChIKey | OZNMYPUUUWCRFE-MRVMKMLHSA-N |
| XLogP | 6.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|