C15H20BrN — CID 142614749
4-bromo-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline;ethane (PubChem CID 142614749) has the molecular formula C15H20BrN and a molecular weight of 294.24 g/mol. Its IUPAC name is 4-bromo-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline;ethane.
| Compound Name | 4-bromo-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline;ethane |
|---|---|
| PubChem CID | 142614749 |
| Molecular Formula | C15H20BrN |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-bromo-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline;ethane |
| SMILES | C=C/C=C(\C=C/C)Nc1ccc(Br)cc1.CC |
| InChI | InChI=1S/C13H14BrN.C2H6/c1-3-5-12(6-4-2)15-13-9-7-11(14)8-10-13;1-2/h3-10,15H,1H2,2H3;1-2H3/b6-4-,12-5+; |
| InChIKey | YLMVJLXKYQFQOB-QRGVYOGNSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|