C25H34N2 — CID 174248069
4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene-1,4-diamine (PubChem CID 174248069) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 174248069 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 4-N-[(2Z,4E)-7,7-dimethyl-6-methylideneocta-2,4-dien-4-yl]-1-N-[(3E,5Z)-octa-1,3,5-trien-4-yl]benzene-1,4-diamine |
| SMILES | C=C/C=C(\C=C/CC)Nc1ccc(NC(/C=C\C)=C/C(=C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34N2/c1-8-11-14-21(12-9-2)26-22-15-17-23(18-16-22)27-24(13-10-3)19-20(4)25(5,6)7/h9-19,26-27H,2,4,8H2,1,3,5-7H3/b13-10-,14-11-,21-12+,24-19+ |
| InChIKey | CQXMFAAFTZXRRT-XRQNBTMRSA-N |
| XLogP | 7.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|