C30H29NP+ — CID 101071939
[(1Z,3E)-2-anilinohexa-1,3-dienyl]-triphenylphosphanium (PubChem CID 101071939) has the molecular formula C30H29NP+ and a molecular weight of 434.54 g/mol. Its IUPAC name is [(1Z,3E)-2-anilinohexa-1,3-dienyl]-triphenylphosphanium.
| Compound Name | [(1Z,3E)-2-anilinohexa-1,3-dienyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 101071939 |
| Molecular Formula | C30H29NP+ |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | [(1Z,3E)-2-anilinohexa-1,3-dienyl]-triphenylphosphanium |
| SMILES | CC/C=C/C(=C/[P+](c1ccccc1)(c1ccccc1)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C30H29NP/c1-2-3-16-27(31-26-17-8-4-9-18-26)25-32(28-19-10-5-11-20-28,29-21-12-6-13-22-29)30-23-14-7-15-24-30/h3-25,31H,2H2,1H3/q+1/b16-3+,27-25- |
| InChIKey | RVPGTPZHOQXZMB-JTJRFGRGSA-N |
| XLogP | 6.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|