C34H28N2O2P+ — CID 4165172
(3-anilino-2-benzamido-3-oxoprop-1-enyl)-triphenylphosphanium (PubChem CID 4165172) has the molecular formula C34H28N2O2P+ and a molecular weight of 527.58 g/mol. Its IUPAC name is (3-anilino-2-benzamido-3-oxoprop-1-enyl)-triphenylphosphanium.
| Compound Name | (3-anilino-2-benzamido-3-oxoprop-1-enyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 4165172 |
| Molecular Formula | C34H28N2O2P+ |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (3-anilino-2-benzamido-3-oxoprop-1-enyl)-triphenylphosphanium |
| SMILES | O=C(Nc1ccccc1)C(=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H27N2O2P/c37-33(27-16-6-1-7-17-27)36-32(34(38)35-28-18-8-2-9-19-28)26-39(29-20-10-3-11-21-29,30-22-12-4-13-23-30)31-24-14-5-15-25-31/h1-26H,(H-,35,36,37,38)/p+1 |
| InChIKey | OFCTUUKUUNAGKT-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|