C33H26Cl2N3O2P — CID 45047243
[(Z)-2-benzamido-3-[(5-chloro-2-pyridinyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium chloride (PubChem CID 45047243) has the molecular formula C33H26Cl2N3O2P and a molecular weight of 598.47 g/mol. Its IUPAC name is [(Z)-2-benzamido-3-[(5-chloro-2-pyridinyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium chloride.
| Compound Name | [(Z)-2-benzamido-3-[(5-chloro-2-pyridinyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 45047243 |
| Molecular Formula | C33H26Cl2N3O2P |
| Molecular Weight | 598.47 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | [(Z)-2-benzamido-3-[(5-chloro-2-pyridinyl)amino]-3-oxoprop-1-enyl]-triphenylphosphanium chloride |
| SMILES | O=C(Nc1ccc(Cl)cn1)/C(=C/[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C33H25ClN3O2P.ClH/c34-26-21-22-31(35-23-26)37-33(39)30(36-32(38)25-13-5-1-6-14-25)24-40(27-15-7-2-8-16-27,28-17-9-3-10-18-28)29-19-11-4-12-20-29;/h1-24H,(H-,35,36,37,38,39);1H/b30-24-; |
| InChIKey | SVIWTMMSLBAUJG-BXMGYBSLSA-N |
| XLogP | 2.94 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|