C34H27ClN2O2P+ — CID 4690831
[2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium (PubChem CID 4690831) has the molecular formula C34H27ClN2O2P+ and a molecular weight of 562.03 g/mol. Its IUPAC name is [2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium.
| Compound Name | [2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 4690831 |
| Molecular Formula | C34H27ClN2O2P+ |
| Molecular Weight | 562.03 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | [2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(=C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H26ClN2O2P/c35-27-21-23-28(24-22-27)36-34(39)32(37-33(38)26-13-5-1-6-14-26)25-40(29-15-7-2-8-16-29,30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-25H,(H-,36,37,38,39)/p+1 |
| InChIKey | SKGHOOXMHBIXBB-UHFFFAOYSA-O |
| XLogP | 6.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.03 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|