C34H27Cl2N2O2P — CID 75366381
[(Z)-2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium chloride (PubChem CID 75366381) has the molecular formula C34H27Cl2N2O2P and a molecular weight of 597.48 g/mol. Its IUPAC name is [(Z)-2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium chloride.
| Compound Name | [(Z)-2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 75366381 |
| Molecular Formula | C34H27Cl2N2O2P |
| Molecular Weight | 597.48 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | [(Z)-2-benzamido-3-(4-chloroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium chloride |
| SMILES | O=C(Nc1ccc(Cl)cc1)/C(=C/[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C34H26ClN2O2P.ClH/c35-27-21-23-28(24-22-27)36-34(39)32(37-33(38)26-13-5-1-6-14-26)25-40(29-15-7-2-8-16-29,30-17-9-3-10-18-30)31-19-11-4-12-20-31;/h1-25H,(H-,36,37,38,39);1H/b32-25-; |
| InChIKey | CRKIXIFYZPFZHS-KMHUKDJRSA-N |
| XLogP | 3.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|