C35H29N3O5P+ — CID 51062830
[(Z)-2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium (PubChem CID 51062830) has the molecular formula C35H29N3O5P+ and a molecular weight of 602.61 g/mol. Its IUPAC name is [(Z)-2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium.
| Compound Name | [(Z)-2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 51062830 |
| Molecular Formula | C35H29N3O5P+ |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | [(Z)-2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium |
| SMILES | COc1ccc(NC(=O)/C(=C/[P+](c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C35H28N3O5P/c1-43-33-23-22-27(24-32(33)38(41)42)36-35(40)31(37-34(39)26-14-6-2-7-15-26)25-44(28-16-8-3-9-17-28,29-18-10-4-11-19-29)30-20-12-5-13-21-30/h2-25H,1H3,(H-,36,37,39,40)/p+1/b31-25- |
| InChIKey | XJZYSUPUISBHBY-GDWJVWIDSA-O |
| XLogP | 5.81 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|