C29H26ClNO7P+ — CID 126958091
[(E)-2-benzamido-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid (PubChem CID 126958091) has the molecular formula C29H26ClNO7P+ and a molecular weight of 566.95 g/mol. Its IUPAC name is [(E)-2-benzamido-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid.
| Compound Name | [(E)-2-benzamido-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid |
|---|---|
| PubChem CID | 126958091 |
| Molecular Formula | C29H26ClNO7P+ |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | [(E)-2-benzamido-3-methoxy-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid |
| SMILES | COC(=O)/C(=C\[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C29H24NO3P.ClHO4/c1-33-29(32)27(30-28(31)23-14-6-2-7-15-23)22-34(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26;2-1(3,4)5/h2-22H,1H3;(H,2,3,4,5)/p+1/b27-22+; |
| InChIKey | WIJDYRALFHMQLS-NYUAYZFWSA-O |
| XLogP | 0.30 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|