C35H30ClN2O6P — CID 134081617
[(Z)-2-benzamido-3-(benzylamino)-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate (PubChem CID 134081617) has the molecular formula C35H30ClN2O6P and a molecular weight of 641.06 g/mol. Its IUPAC name is [(Z)-2-benzamido-3-(benzylamino)-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate.
| Compound Name | [(Z)-2-benzamido-3-(benzylamino)-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate |
|---|---|
| PubChem CID | 134081617 |
| Molecular Formula | C35H30ClN2O6P |
| Molecular Weight | 641.06 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | [(Z)-2-benzamido-3-(benzylamino)-3-oxoprop-1-enyl]-triphenylphosphanium perchlorate |
| SMILES | O=C(NCc1ccccc1)/C(=C/[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C35H29N2O2P.ClHO4/c38-34(29-18-8-2-9-19-29)37-33(35(39)36-26-28-16-6-1-7-17-28)27-40(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32;2-1(3,4)5/h1-25,27H,26H2,(H-,36,37,38,39);(H,2,3,4,5)/b33-27-; |
| InChIKey | SASWQAHBGZUKJC-AIZXEQHCSA-N |
| XLogP | 0.81 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.06 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|