C23H21NO6 — CID 59187976
dimethyl (2Z,4Z)-2-benzamido-5-phenacylhexa-2,4-dienedioate (PubChem CID 59187976) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is dimethyl (2Z,4Z)-2-benzamido-5-phenacylhexa-2,4-dienedioate.
| Compound Name | dimethyl (2Z,4Z)-2-benzamido-5-phenacylhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 59187976 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | dimethyl (2Z,4Z)-2-benzamido-5-phenacylhexa-2,4-dienedioate |
| SMILES | COC(=O)/C(=C\C=C(/NC(=O)c1ccccc1)C(=O)OC)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO6/c1-29-22(27)18(15-20(25)16-9-5-3-6-10-16)13-14-19(23(28)30-2)24-21(26)17-11-7-4-8-12-17/h3-14H,15H2,1-2H3,(H,24,26)/b18-13-,19-14- |
| InChIKey | HKBUDSZLAMEECA-SXQSXHJWSA-N |
| XLogP | 2.85 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|