C44H51N3O9 — CID 158516534
dimethyl (6Z)-2,7-dibenzamidoocta-2,4,6-trienedioate;2,2-dimethylpropane;methyl (2Z)-2-benzamido-5-methylhexa-2,4-dienoate (PubChem CID 158516534) has the molecular formula C44H51N3O9 and a molecular weight of 765.90 g/mol. Its IUPAC name is dimethyl (6Z)-2,7-dibenzamidoocta-2,4,6-trienedioate;2,2-dimethylpropane;methyl (2Z)-2-benzamido-5-methylhexa-2,4-dienoate.
| Compound Name | dimethyl (6Z)-2,7-dibenzamidoocta-2,4,6-trienedioate;2,2-dimethylpropane;methyl (2Z)-2-benzamido-5-methylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 158516534 |
| Molecular Formula | C44H51N3O9 |
| Molecular Weight | 765.90 g/mol |
| Exact Mass | 765.36 |
| IUPAC Name | dimethyl (6Z)-2,7-dibenzamidoocta-2,4,6-trienedioate;2,2-dimethylpropane;methyl (2Z)-2-benzamido-5-methylhexa-2,4-dienoate |
| SMILES | CC(C)(C)C.COC(=O)/C(=C/C=C(C)C)NC(=O)c1ccccc1.COC(=O)C(=CC=C/C=C(\NC(=O)c1ccccc1)C(=O)OC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O6.C15H17NO3.C5H12/c1-31-23(29)19(25-21(27)17-11-5-3-6-12-17)15-9-10-16-20(24(30)32-2)26-22(28)18-13-7-4-8-14-18;1-11(2)9-10-13(15(18)19-3)16-14(17)12-7-5-4-6-8-12;1-5(2,3)4/h3-16H,1-2H3,(H,25,27)(H,26,28);4-10H,1-3H3,(H,16,17);1-4H3/b10-9?,19-15-,20-16?;13-10-; |
| InChIKey | HLRUCJQJLRIURF-HFMZCNHASA-N |
| XLogP | 7.01 |
| TPSA | 166.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.90 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|