C35H30ClN3O9P+ — CID 126959504
[2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid (PubChem CID 126959504) has the molecular formula C35H30ClN3O9P+ and a molecular weight of 703.06 g/mol. Its IUPAC name is [2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid.
| Compound Name | [2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid |
|---|---|
| PubChem CID | 126959504 |
| Molecular Formula | C35H30ClN3O9P+ |
| Molecular Weight | 703.06 g/mol |
| Exact Mass | 702.14 |
| IUPAC Name | [2-benzamido-3-(4-methoxy-3-nitroanilino)-3-oxoprop-1-enyl]-triphenylphosphanium;perchloric acid |
| SMILES | COc1ccc(NC(=O)C(=C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)NC(=O)c2ccccc2)cc1[N+](=O)[O-].[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C35H28N3O5P.ClHO4/c1-43-33-23-22-27(24-32(33)38(41)42)36-35(40)31(37-34(39)26-14-6-2-7-15-26)25-44(28-16-8-3-9-17-28,29-18-10-4-11-19-29)30-20-12-5-13-21-30;2-1(3,4)5/h2-25H,1H3,(H-,36,37,39,40);(H,2,3,4,5)/p+1 |
| InChIKey | OMGHSEUBDBDKRN-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 199.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.06 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|