C24H21N3O7 — CID 3795034
N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-(2-hydroxyanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 3795034) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-(2-hydroxyanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-(2-hydroxyanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 3795034 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-(2-hydroxyanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cc(C=C(NC(=O)c2ccccc2)C(=O)Nc2ccccc2O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H21N3O7/c1-33-21-13-16(19(27(31)32)14-22(21)34-2)12-18(26-23(29)15-8-4-3-5-9-15)24(30)25-17-10-6-7-11-20(17)28/h3-14,28H,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | HINJIDSMKHFMDY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|