C25H20F3N3O7 — CID 91969772
N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide (PubChem CID 91969772) has the molecular formula C25H20F3N3O7 and a molecular weight of 531.44 g/mol. Its IUPAC name is N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 91969772 |
| Molecular Formula | C25H20F3N3O7 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | N-[1-(4,5-dimethoxy-2-nitrophenyl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(C=C(NC(=O)c2ccccc2)C(=O)Nc2ccccc2OC(F)(F)F)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H20F3N3O7/c1-36-21-13-16(19(31(34)35)14-22(21)37-2)12-18(30-23(32)15-8-4-3-5-9-15)24(33)29-17-10-6-7-11-20(17)38-25(26,27)28/h3-14H,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | TZBXBQSUEHFAFV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|