C24H16BrF3N2O5 — CID 87047986
N-[(Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide (PubChem CID 87047986) has the molecular formula C24H16BrF3N2O5 and a molecular weight of 549.30 g/mol. Its IUPAC name is N-[(Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 87047986 |
| Molecular Formula | C24H16BrF3N2O5 |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | N-[(Z)-1-(6-bromo-1,3-benzodioxol-5-yl)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)/C(=C/c1cc2c(cc1Br)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H16BrF3N2O5/c25-16-12-21-20(33-13-34-21)11-15(16)10-18(30-22(31)14-6-2-1-3-7-14)23(32)29-17-8-4-5-9-19(17)35-24(26,27)28/h1-12H,13H2,(H,29,32)(H,30,31)/b18-10- |
| InChIKey | XRNITBCEGYOSMT-ZDLGFXPLSA-N |
| XLogP | 5.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|