C24H16F6N2O3 — CID 91969719
N-[3-oxo-3-[4-(trifluoromethoxy)anilino]-1-[2-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzamide (PubChem CID 91969719) has the molecular formula C24H16F6N2O3 and a molecular weight of 494.39 g/mol. Its IUPAC name is N-[3-oxo-3-[4-(trifluoromethoxy)anilino]-1-[2-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzamide.
| Compound Name | N-[3-oxo-3-[4-(trifluoromethoxy)anilino]-1-[2-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 91969719 |
| Molecular Formula | C24H16F6N2O3 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[3-oxo-3-[4-(trifluoromethoxy)anilino]-1-[2-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)C(=Cc1ccccc1C(F)(F)F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H16F6N2O3/c25-23(26,27)19-9-5-4-8-16(19)14-20(32-21(33)15-6-2-1-3-7-15)22(34)31-17-10-12-18(13-11-17)35-24(28,29)30/h1-14H,(H,31,34)(H,32,33) |
| InChIKey | ANHMOJRYKSDRJQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|