C32H26F3N3O3S — CID 19715498
N-[(Z)-3-oxo-3-[4-[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19715498) has the molecular formula C32H26F3N3O3S and a molecular weight of 589.64 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19715498 |
| Molecular Formula | C32H26F3N3O3S |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[1-oxo-1-[2-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C32H26F3N3O3S/c1-21(29(39)37-27-15-9-8-14-26(27)32(33,34)35)42-25-18-16-24(17-19-25)36-31(41)28(20-22-10-4-2-5-11-22)38-30(40)23-12-6-3-7-13-23/h2-21H,1H3,(H,36,41)(H,37,39)(H,38,40)/b28-20- |
| InChIKey | KJNLNKOIGCWWNZ-RRAHZORUSA-N |
| XLogP | 7.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|