C36H27F3N4O3S — CID 22189065
N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22189065) has the molecular formula C36H27F3N4O3S and a molecular weight of 652.70 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189065 |
| Molecular Formula | C36H27F3N4O3S |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[2-oxo-1-phenyl-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccccc2C(F)(F)F)c2ccccc2)cc1)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H27F3N4O3S/c37-36(38,39)29-15-7-8-16-30(29)42-35(46)32(25-11-3-1-4-12-25)47-28-19-17-27(18-20-28)41-34(45)31(22-24-10-9-21-40-23-24)43-33(44)26-13-5-2-6-14-26/h1-23,32H,(H,41,45)(H,42,46)(H,43,44)/b31-22- |
| InChIKey | GEZUTXXLYZVCKB-VAMRJTSQSA-N |
| XLogP | 7.98 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|