C36H27N5O3S2 — CID 19714921
N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19714921) has the molecular formula C36H27N5O3S2 and a molecular weight of 641.78 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714921 |
| Molecular Formula | C36H27N5O3S2 |
| Molecular Weight | 641.78 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2nc3ccccc3s2)c2ccccc2)cc1)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H27N5O3S2/c42-33(26-13-5-2-6-14-26)39-30(22-24-10-9-21-37-23-24)34(43)38-27-17-19-28(20-18-27)45-32(25-11-3-1-4-12-25)35(44)41-36-40-29-15-7-8-16-31(29)46-36/h1-23,32H,(H,38,43)(H,39,42)(H,40,41,44)/b30-22- |
| InChIKey | BIIPBNHKLYVLKQ-SWKFRHMKSA-N |
| XLogP | 7.57 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|