C32H25N5O3S2 — CID 19320801
N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19320801) has the molecular formula C32H25N5O3S2 and a molecular weight of 591.72 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320801 |
| Molecular Formula | C32H25N5O3S2 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-1-phenyl-2-(1,3-thiazol-2-ylamino)ethyl]sulfanylanilino]-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2nccs2)c2ccccc2)c1)/C(=C/c1cccnc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H25N5O3S2/c38-29(24-12-5-2-6-13-24)36-27(19-22-9-8-16-33-21-22)30(39)35-25-14-7-15-26(20-25)42-28(23-10-3-1-4-11-23)31(40)37-32-34-17-18-41-32/h1-21,28H,(H,35,39)(H,36,38)(H,34,37,40)/b27-19- |
| InChIKey | XBNPOXPGYWVVEJ-DIBXZPPDSA-N |
| XLogP | 6.42 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|